C24H26F2N2O2 — CID 68540572
N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-prop-1-ynylphenyl)cyclopropyl]amino]butan-2-yl]acetamide (PubChem CID 68540572) has the molecular formula C24H26F2N2O2 and a molecular weight of 412.48 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-prop-1-ynylphenyl)cyclopropyl]amino]butan-2-yl]acetamide.
| Compound Name | N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-prop-1-ynylphenyl)cyclopropyl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 68540572 |
| Molecular Formula | C24H26F2N2O2 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-prop-1-ynylphenyl)cyclopropyl]amino]butan-2-yl]acetamide |
| SMILES | CC#Cc1cccc(C2(NCC(O)C(Cc3cc(F)cc(F)c3)NC(C)=O)CC2)c1 |
| InChI | InChI=1S/C24H26F2N2O2/c1-3-5-17-6-4-7-19(10-17)24(8-9-24)27-15-23(30)22(28-16(2)29)13-18-11-20(25)14-21(26)12-18/h4,6-7,10-12,14,22-23,27,30H,8-9,13,15H2,1-2H3,(H,28,29) |
| InChIKey | HLDHBLCYIPDANG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|