C25H32F2N2OSi — CID 21062895
4-(3,5-difluorophenyl)-3-(methylamino)-1-[[1-[3-(2-trimethylsilylethynyl)phenyl]cyclopropyl]amino]butan-2-ol (PubChem CID 21062895) has the molecular formula C25H32F2N2OSi and a molecular weight of 442.63 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-3-(methylamino)-1-[[1-[3-(2-trimethylsilylethynyl)phenyl]cyclopropyl]amino]butan-2-ol.
| Compound Name | 4-(3,5-difluorophenyl)-3-(methylamino)-1-[[1-[3-(2-trimethylsilylethynyl)phenyl]cyclopropyl]amino]butan-2-ol |
|---|---|
| PubChem CID | 21062895 |
| Molecular Formula | C25H32F2N2OSi |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-(3,5-difluorophenyl)-3-(methylamino)-1-[[1-[3-(2-trimethylsilylethynyl)phenyl]cyclopropyl]amino]butan-2-ol |
| SMILES | CNC(Cc1cc(F)cc(F)c1)C(O)CNC1(c2cccc(C#C[Si](C)(C)C)c2)CC1 |
| InChI | InChI=1S/C25H32F2N2OSi/c1-28-23(15-19-13-21(26)16-22(27)14-19)24(30)17-29-25(9-10-25)20-7-5-6-18(12-20)8-11-31(2,3)4/h5-7,12-14,16,23-24,28-30H,9-10,15,17H2,1-4H3 |
| InChIKey | YDWNSRMIZDXYER-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|