C22H22F2N2O3 — CID 21085147
[1-(3,5-difluorophenyl)-4-[[1-(3-ethynylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]carbamic acid (PubChem CID 21085147) has the molecular formula C22H22F2N2O3 and a molecular weight of 400.43 g/mol. Its IUPAC name is [1-(3,5-difluorophenyl)-4-[[1-(3-ethynylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]carbamic acid.
| Compound Name | [1-(3,5-difluorophenyl)-4-[[1-(3-ethynylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 21085147 |
| Molecular Formula | C22H22F2N2O3 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | [1-(3,5-difluorophenyl)-4-[[1-(3-ethynylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]carbamic acid |
| SMILES | C#Cc1cccc(C2(NCC(O)C(Cc3cc(F)cc(F)c3)NC(=O)O)CC2)c1 |
| InChI | InChI=1S/C22H22F2N2O3/c1-2-14-4-3-5-16(8-14)22(6-7-22)25-13-20(27)19(26-21(28)29)11-15-9-17(23)12-18(24)10-15/h1,3-5,8-10,12,19-20,25-27H,6-7,11,13H2,(H,28,29) |
| InChIKey | JXIKMOJCEPXDJN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|