C24H29F2IN2O2 — CID 58591323
N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-iodophenyl)cyclohexyl]amino]butan-2-yl]acetamide (PubChem CID 58591323) has the molecular formula C24H29F2IN2O2 and a molecular weight of 542.41 g/mol. Its IUPAC name is N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-iodophenyl)cyclohexyl]amino]butan-2-yl]acetamide.
| Compound Name | N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-iodophenyl)cyclohexyl]amino]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 58591323 |
| Molecular Formula | C24H29F2IN2O2 |
| Molecular Weight | 542.41 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-iodophenyl)cyclohexyl]amino]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(Cc1cc(F)cc(F)c1)C(O)CNC1(c2cccc(I)c2)CCCCC1 |
| InChI | InChI=1S/C24H29F2IN2O2/c1-16(30)29-22(12-17-10-19(25)14-20(26)11-17)23(31)15-28-24(8-3-2-4-9-24)18-6-5-7-21(27)13-18/h5-7,10-11,13-14,22-23,28,31H,2-4,8-9,12,15H2,1H3,(H,29,30) |
| InChIKey | NMVADCDYVIVWHB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|