C24H31BF2N2O4 — CID 70332629
[3-[1-[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]cyclohexyl]phenyl]boronic acid (PubChem CID 70332629) has the molecular formula C24H31BF2N2O4 and a molecular weight of 460.33 g/mol. Its IUPAC name is [3-[1-[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]cyclohexyl]phenyl]boronic acid.
| Compound Name | [3-[1-[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]cyclohexyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 70332629 |
| Molecular Formula | C24H31BF2N2O4 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | [3-[1-[[(2R,3S)-3-acetamido-4-(3,5-difluorophenyl)-2-hydroxybutyl]amino]cyclohexyl]phenyl]boronic acid |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNC1(c2cccc(B(O)O)c2)CCCCC1 |
| InChI | InChI=1S/C24H31BF2N2O4/c1-16(30)29-22(12-17-10-20(26)14-21(27)11-17)23(31)15-28-24(8-3-2-4-9-24)18-6-5-7-19(13-18)25(32)33/h5-7,10-11,13-14,22-23,28,31-33H,2-4,8-9,12,15H2,1H3,(H,29,30)/t22-,23+/m0/s1 |
| InChIKey | SNTNEVGSMJSGPF-XZOQPEGZSA-N |
| XLogP | 1.50 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|