C35H41F2N3O3 — CID 21084911
3-(butylamino)-N-[1-(3,5-difluorophenyl)-4-[[1-(3-ethynylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]-4-(2-methoxyethyl)benzamide (PubChem CID 21084911) has the molecular formula C35H41F2N3O3 and a molecular weight of 589.73 g/mol. Its IUPAC name is 3-(butylamino)-N-[1-(3,5-difluorophenyl)-4-[[1-(3-ethynylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]-4-(2-methoxyethyl)benzamide.
| Compound Name | 3-(butylamino)-N-[1-(3,5-difluorophenyl)-4-[[1-(3-ethynylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]-4-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 21084911 |
| Molecular Formula | C35H41F2N3O3 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | 3-(butylamino)-N-[1-(3,5-difluorophenyl)-4-[[1-(3-ethynylphenyl)cyclopropyl]amino]-3-hydroxybutan-2-yl]-4-(2-methoxyethyl)benzamide |
| SMILES | C#Cc1cccc(C2(NCC(O)C(Cc3cc(F)cc(F)c3)NC(=O)c3ccc(CCOC)c(NCCCC)c3)CC2)c1 |
| InChI | InChI=1S/C35H41F2N3O3/c1-4-6-15-38-31-21-27(11-10-26(31)12-16-43-3)34(42)40-32(20-25-18-29(36)22-30(37)19-25)33(41)23-39-35(13-14-35)28-9-7-8-24(5-2)17-28/h2,7-11,17-19,21-22,32-33,38-39,41H,4,6,12-16,20,23H2,1,3H3,(H,40,42) |
| InChIKey | UFTLSGLWHIQXMH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|