C37H47F2N3O4 — CID 129054328
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-methoxyphenyl)cyclohexyl]amino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 129054328) has the molecular formula C37H47F2N3O4 and a molecular weight of 635.80 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-methoxyphenyl)cyclohexyl]amino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-methoxyphenyl)cyclohexyl]amino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 129054328 |
| Molecular Formula | C37H47F2N3O4 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.35 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[1-(3-methoxyphenyl)cyclohexyl]amino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNC2(c3cccc(OC)c3)CCCCC2)c1 |
| InChI | InChI=1S/C37H47F2N3O4/c1-4-17-42(18-5-2)36(45)28-12-9-11-27(22-28)35(44)41-33(21-26-19-30(38)24-31(39)20-26)34(43)25-40-37(15-7-6-8-16-37)29-13-10-14-32(23-29)46-3/h9-14,19-20,22-24,33-34,40,43H,4-8,15-18,21,25H2,1-3H3,(H,41,44)/t33-,34+/m0/s1 |
| InChIKey | DDEFXKIOFKTCIQ-SZAHLOSFSA-N |
| XLogP | 6.39 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |