C28H39F2N3O3 — CID 87872559
N-[(2S,3S)-4-[[1-(3-tert-butylphenyl)-4-(hydroxyamino)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 87872559) has the molecular formula C28H39F2N3O3 and a molecular weight of 503.63 g/mol. Its IUPAC name is N-[(2S,3S)-4-[[1-(3-tert-butylphenyl)-4-(hydroxyamino)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3S)-4-[[1-(3-tert-butylphenyl)-4-(hydroxyamino)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 87872559 |
| Molecular Formula | C28H39F2N3O3 |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | N-[(2S,3S)-4-[[1-(3-tert-butylphenyl)-4-(hydroxyamino)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@@H](O)CNC1(c2cccc(C(C)(C)C)c2)CCC(NO)CC1 |
| InChI | InChI=1S/C28H39F2N3O3/c1-18(34)32-25(14-19-12-22(29)16-23(30)13-19)26(35)17-31-28(10-8-24(33-36)9-11-28)21-7-5-6-20(15-21)27(2,3)4/h5-7,12-13,15-16,24-26,31,33,35-36H,8-11,14,17H2,1-4H3,(H,32,34)/t24?,25-,26-,28?/m0/s1 |
| InChIKey | ROMPPUBSQJCGMZ-UVVJCTJISA-N |
| XLogP | 4.08 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|