C29H41F2N3O3 — CID 11443763
N-[4-[[1-(3-tert-butylphenyl)-4-(methoxyamino)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 11443763) has the molecular formula C29H41F2N3O3 and a molecular weight of 517.66 g/mol. Its IUPAC name is N-[4-[[1-(3-tert-butylphenyl)-4-(methoxyamino)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[4-[[1-(3-tert-butylphenyl)-4-(methoxyamino)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 11443763 |
| Molecular Formula | C29H41F2N3O3 |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | N-[4-[[1-(3-tert-butylphenyl)-4-(methoxyamino)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CONC1CCC(NCC(O)C(Cc2cc(F)cc(F)c2)NC(C)=O)(c2cccc(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C29H41F2N3O3/c1-19(35)33-26(15-20-13-23(30)17-24(31)14-20)27(36)18-32-29(11-9-25(10-12-29)34-37-5)22-8-6-7-21(16-22)28(2,3)4/h6-8,13-14,16-17,25-27,32,34,36H,9-12,15,18H2,1-5H3,(H,33,35) |
| InChIKey | ZPEPUUZZYFRKHZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|