C31H42F2N4O3 — CID 143171385
N-[4-[[4-[acetyl(methyl)hydrazinylidene]-1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide (PubChem CID 143171385) has the molecular formula C31H42F2N4O3 and a molecular weight of 556.70 g/mol. Its IUPAC name is N-[4-[[4-[acetyl(methyl)hydrazinylidene]-1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[4-[[4-[acetyl(methyl)hydrazinylidene]-1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 143171385 |
| Molecular Formula | C31H42F2N4O3 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.32 |
| IUPAC Name | N-[4-[[4-[acetyl(methyl)hydrazinylidene]-1-(3-tert-butylphenyl)cyclohexyl]amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)NC(Cc1cc(F)cc(F)c1)C(O)CNC1(c2cccc(C(C)(C)C)c2)CCC(=NN(C)C(C)=O)CC1 |
| InChI | InChI=1S/C31H42F2N4O3/c1-20(38)35-28(16-22-14-25(32)18-26(33)15-22)29(40)19-34-31(24-9-7-8-23(17-24)30(3,4)5)12-10-27(11-13-31)36-37(6)21(2)39/h7-9,14-15,17-18,28-29,34,40H,10-13,16,19H2,1-6H3,(H,35,38)/b36-27- |
| InChIKey | FQENHSKEGIUCKV-RLANJUCJSA-N |
| XLogP | 4.56 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|