C15H19FN4O — CID 68541593
2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-4-fluorophenol (PubChem CID 68541593) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-4-fluorophenol.
| Compound Name | 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 68541593 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[[4-(1,4-dihydropyrimidin-6-yl)piperazin-1-yl]methyl]-4-fluorophenol |
| SMILES | Oc1ccc(F)cc1CN1CCN(C2=CCN=CN2)CC1 |
| InChI | InChI=1S/C15H19FN4O/c16-13-1-2-14(21)12(9-13)10-19-5-7-20(8-6-19)15-3-4-17-11-18-15/h1-3,9,11,21H,4-8,10H2,(H,17,18) |
| InChIKey | GGGMIWSJUXAWLG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|