C19H16N2O4 — CID 68542252
4-(2-methyl-1,3-dioxoisoindol-5-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 68542252) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-(2-methyl-1,3-dioxoisoindol-5-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | 4-(2-methyl-1,3-dioxoisoindol-5-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 68542252 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-(2-methyl-1,3-dioxoisoindol-5-yl)-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | CN1C(=O)c2ccc(N3C(=O)C4C5C=CC(CC5)C4C3=O)cc2C1=O |
| InChI | InChI=1S/C19H16N2O4/c1-20-16(22)12-7-6-11(8-13(12)17(20)23)21-18(24)14-9-2-3-10(5-4-9)15(14)19(21)25/h2-3,6-10,14-15H,4-5H2,1H3 |
| InChIKey | YEVREHKCWZMSRN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|