C17H13NO4 — CID 68542633
(1R,2S,6R,7S)-4-(1-oxo-3H-2-benzofuran-5-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 68542633) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-(1-oxo-3H-2-benzofuran-5-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-4-(1-oxo-3H-2-benzofuran-5-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 68542633 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (1R,2S,6R,7S)-4-(1-oxo-3H-2-benzofuran-5-yl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1OCc2cc(N3C(=O)[C@@H]4[C@H](C3=O)[C@@H]3C=C[C@H]4C3)ccc21 |
| InChI | InChI=1S/C17H13NO4/c19-15-13-8-1-2-9(5-8)14(13)16(20)18(15)11-3-4-12-10(6-11)7-22-17(12)21/h1-4,6,8-9,13-14H,5,7H2/t8-,9+,13-,14+ |
| InChIKey | BASVYJCHOBDSLJ-OGXIQJDLSA-N |
| XLogP | 1.67 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|