C34H46O4 — CID 68545313
[(1S,2S,4S,6R,7S,8R,9S,12S,13R)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]-phenylmethanone (PubChem CID 68545313) has the molecular formula C34H46O4 and a molecular weight of 518.74 g/mol. Its IUPAC name is [(1S,2S,4S,6R,7S,8R,9S,12S,13R)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]-phenylmethanone.
| Compound Name | [(1S,2S,4S,6R,7S,8R,9S,12S,13R)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]-phenylmethanone |
|---|---|
| PubChem CID | 68545313 |
| Molecular Formula | C34H46O4 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | [(1S,2S,4S,6R,7S,8R,9S,12S,13R)-16-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl]-phenylmethanone |
| SMILES | CC1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC=C5CC(O)(C(=O)c6ccccc6)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C34H46O4/c1-21-12-15-34(37-20-21)22(2)29-28(38-34)18-27-25-11-10-24-19-33(36,30(35)23-8-6-5-7-9-23)17-16-31(24,3)26(25)13-14-32(27,29)4/h5-10,21-22,25-29,36H,11-20H2,1-4H3/t21?,22-,25+,26-,27-,28-,29-,31-,32-,33?,34+/m0/s1 |
| InChIKey | SXKBFAKRPALKNN-CFTMFNFTSA-N |
| XLogP | 6.97 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|