C40H58N2O4 — CID 46926810
[(1S,2S,4S,5'R,6S,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] 2-(4-benzylpiperazin-1-yl)acetate (PubChem CID 46926810) has the molecular formula C40H58N2O4 and a molecular weight of 630.91 g/mol. Its IUPAC name is [(1S,2S,4S,5'R,6S,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] 2-(4-benzylpiperazin-1-yl)acetate.
| Compound Name | [(1S,2S,4S,5'R,6S,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] 2-(4-benzylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 46926810 |
| Molecular Formula | C40H58N2O4 |
| Molecular Weight | 630.91 g/mol |
| Exact Mass | 630.44 |
| IUPAC Name | [(1S,2S,4S,5'R,6S,7S,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] 2-(4-benzylpiperazin-1-yl)acetate |
| SMILES | C[C@@H]1CC[C@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](OC(=O)CN6CCN(Cc7ccccc7)CC6)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C40H58N2O4/c1-27-12-17-40(44-26-27)28(2)37-35(46-40)23-34-32-11-10-30-22-31(13-15-38(30,3)33(32)14-16-39(34,37)4)45-36(43)25-42-20-18-41(19-21-42)24-29-8-6-5-7-9-29/h5-10,27-28,31-35,37H,11-26H2,1-4H3/t27-,28+,31+,32-,33+,34+,35+,37+,38+,39+,40+/m1/s1 |
| InChIKey | VHPGHFXDPOLHSB-FXHQQHPYSA-N |
| XLogP | 7.08 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.91 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|