C28H43NO4 — CID 129120057
[(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] 2-aminoacetate (PubChem CID 129120057) has the molecular formula C28H43NO4 and a molecular weight of 457.66 g/mol. Its IUPAC name is [(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] 2-aminoacetate.
| Compound Name | [(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 129120057 |
| Molecular Formula | C28H43NO4 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | [(1S,2S,4S,6R,7S,8R,9S,12S,13R,16S)-7,9,13-trimethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-oxane]-16-yl] 2-aminoacetate |
| SMILES | C[C@H]1[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@@H](OC(=O)CN)CC[C@]5(C)[C@H]4CC[C@]23C)O[C@]12CCCCO2 |
| InChI | InChI=1S/C28H43NO4/c1-17-25-23(33-28(17)10-4-5-13-31-28)15-22-20-7-6-18-14-19(32-24(30)16-29)8-11-26(18,2)21(20)9-12-27(22,25)3/h6,17,19-23,25H,4-5,7-16,29H2,1-3H3/t17-,19-,20+,21-,22-,23-,25-,26-,27-,28+/m0/s1 |
| InChIKey | LJBLLFUZYQZXLD-ZJJRXKIISA-N |
| XLogP | 4.98 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|