C30H47NO3 — CID 3819721
(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl) propanoate (PubChem CID 3819721) has the molecular formula C30H47NO3 and a molecular weight of 469.71 g/mol. Its IUPAC name is (5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl) propanoate.
| Compound Name | (5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl) propanoate |
|---|---|
| PubChem CID | 3819721 |
| Molecular Formula | C30H47NO3 |
| Molecular Weight | 469.71 g/mol |
| Exact Mass | 469.36 |
| IUPAC Name | (5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl) propanoate |
| SMILES | CCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C3CC3OC4(CCC(C)CN4)C(C)C32)C1 |
| InChI | InChI=1S/C30H47NO3/c1-6-26(32)33-21-10-12-28(4)20(15-21)7-8-22-23(28)11-13-29(5)24(22)16-25-27(29)19(3)30(34-25)14-9-18(2)17-31-30/h7,18-19,21-25,27,31H,6,8-17H2,1-5H3 |
| InChIKey | RRKWIQVQKFFJJW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.71 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|