C39H63NO11 — CID 78173081
6-[[3,5-dihydroxy-2-methyl-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl)oxyoxan-4-yl]oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 78173081) has the molecular formula C39H63NO11 and a molecular weight of 721.93 g/mol. Its IUPAC name is 6-[[3,5-dihydroxy-2-methyl-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl)oxyoxan-4-yl]oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | 6-[[3,5-dihydroxy-2-methyl-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl)oxyoxan-4-yl]oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 78173081 |
| Molecular Formula | C39H63NO11 |
| Molecular Weight | 721.93 g/mol |
| Exact Mass | 721.44 |
| IUPAC Name | 6-[[3,5-dihydroxy-2-methyl-6-(5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl)oxyoxan-4-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | CC1CCC2(NC1)OC1CC3C4CC=C5CC(OC6OC(C)C(O)C(OCC7OC(O)C(O)C(O)C7O)C6O)CCC5(C)C4CCC3(C)C1C2C |
| InChI | InChI=1S/C39H63NO11/c1-18-8-13-39(40-16-18)19(2)28-26(51-39)15-25-23-7-6-21-14-22(9-11-37(21,4)24(23)10-12-38(25,28)5)49-36-33(45)34(29(41)20(3)48-36)47-17-27-30(42)31(43)32(44)35(46)50-27/h6,18-20,22-36,40-46H,7-17H2,1-5H3 |
| InChIKey | SGEKLQMLYWFVFY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 179.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.93 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|