C33H53NO7 — CID 91133921
(3S,4S,6R)-2-(hydroxymethyl)-6-[(6R,7S,9S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxyoxane-3,4,5-triol (PubChem CID 91133921) has the molecular formula C33H53NO7 and a molecular weight of 575.79 g/mol. Its IUPAC name is (3S,4S,6R)-2-(hydroxymethyl)-6-[(6R,7S,9S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxyoxane-3,4,5-triol.
| Compound Name | (3S,4S,6R)-2-(hydroxymethyl)-6-[(6R,7S,9S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 91133921 |
| Molecular Formula | C33H53NO7 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.38 |
| IUPAC Name | (3S,4S,6R)-2-(hydroxymethyl)-6-[(6R,7S,9S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxyoxane-3,4,5-triol |
| SMILES | CC1CC[C@@]2(NC1)OC1CC3C4CC=C5C[C@@H](O[C@@H]6OC(CO)[C@@H](O)[C@H](O)C6O)CC[C@]5(C)C4CC[C@]3(C)C1C2C |
| InChI | InChI=1S/C33H53NO7/c1-17-7-12-33(34-15-17)18(2)26-24(41-33)14-23-21-6-5-19-13-20(8-10-31(19,3)22(21)9-11-32(23,26)4)39-30-29(38)28(37)27(36)25(16-35)40-30/h5,17-18,20-30,34-38H,6-16H2,1-4H3/t17?,18?,20-,21?,22?,23?,24?,25?,26?,27+,28-,29?,30+,31-,32-,33+/m0/s1 |
| InChIKey | XMLLJGHZPHTUKK-SGSQBDGVSA-N |
| XLogP | 3.11 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|