C27H43NO2 — CID 5321385
(9S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-ol (PubChem CID 5321385) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is (9S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-ol.
| Compound Name | (9S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-ol |
|---|---|
| PubChem CID | 5321385 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | (9S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-ol |
| SMILES | CC1CCC2(NC1)OC1CC3C4CC=C5C[C@@H](O)CC[C@]5(C)C4CC[C@]3(C)C1C2C |
| InChI | InChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16?,17?,19-,20?,21?,22?,23?,24?,25-,26-,27?/m0/s1 |
| InChIKey | KWVISVAMQJWJSZ-PDOLIOMLSA-N |
| XLogP | 5.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|