C31H51N3O2 — CID 176806614
2-(dimethylamino)-N-[(1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]acetamide (PubChem CID 176806614) has the molecular formula C31H51N3O2 and a molecular weight of 497.77 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[(1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[(1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]acetamide |
|---|---|
| PubChem CID | 176806614 |
| Molecular Formula | C31H51N3O2 |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 497.40 |
| IUPAC Name | 2-(dimethylamino)-N-[(1S,2S,4S,5'R,6R,7S,8R,9S,12S,13R)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]acetamide |
| SMILES | C[C@@H]1CC[C@@]2(NC1)O[C@H]1C[C@H]3[C@@H]4CC=C5CC(NC(=O)CN(C)C)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| InChI | InChI=1S/C31H51N3O2/c1-19-9-14-31(32-17-19)20(2)28-26(36-31)16-25-23-8-7-21-15-22(33-27(35)18-34(5)6)10-12-29(21,3)24(23)11-13-30(25,28)4/h7,19-20,22-26,28,32H,8-18H2,1-6H3,(H,33,35)/t19-,20+,22?,23-,24+,25+,26+,28+,29+,30+,31-/m1/s1 |
| InChIKey | BPOJLWLVTPQPFD-CIBKMNORSA-N |
| XLogP | 4.97 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|