C34H47NO3 — CID 99576078
[(1S,2S,4S,5'S,6S,7R,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl] benzoate (PubChem CID 99576078) has the molecular formula C34H47NO3 and a molecular weight of 517.75 g/mol. Its IUPAC name is [(1S,2S,4S,5'S,6S,7R,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl] benzoate.
| Compound Name | [(1S,2S,4S,5'S,6S,7R,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl] benzoate |
|---|---|
| PubChem CID | 99576078 |
| Molecular Formula | C34H47NO3 |
| Molecular Weight | 517.75 g/mol |
| Exact Mass | 517.36 |
| IUPAC Name | [(1S,2S,4S,5'S,6S,7R,8R,9S,12S,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl] benzoate |
| SMILES | C[C@H]1CC[C@]2(NC1)O[C@H]1C[C@H]3[C@@H]4CC=C5C[C@@H](OC(=O)c6ccccc6)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@H]2C |
| InChI | InChI=1S/C34H47NO3/c1-21-12-17-34(35-20-21)22(2)30-29(38-34)19-28-26-11-10-24-18-25(37-31(36)23-8-6-5-7-9-23)13-15-32(24,3)27(26)14-16-33(28,30)4/h5-10,21-22,25-30,35H,11-20H2,1-4H3/t21-,22+,25-,26+,27-,28-,29-,30-,32-,33-,34-/m0/s1 |
| InChIKey | KVEGADOINRXKBW-KANAYUSESA-N |
| XLogP | 7.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.75 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|