C19H31N5O2 — CID 68545431
tert-butyl (2R)-4-(2-amino-6-cyclopentylpyrimidin-4-yl)-2-methylpiperazine-1-carboxylate (PubChem CID 68545431) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is tert-butyl (2R)-4-(2-amino-6-cyclopentylpyrimidin-4-yl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(2-amino-6-cyclopentylpyrimidin-4-yl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 68545431 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | tert-butyl (2R)-4-(2-amino-6-cyclopentylpyrimidin-4-yl)-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(C3CCCC3)nc(N)n2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31N5O2/c1-13-12-23(9-10-24(13)18(25)26-19(2,3)4)16-11-15(21-17(20)22-16)14-7-5-6-8-14/h11,13-14H,5-10,12H2,1-4H3,(H2,20,21,22)/t13-/m1/s1 |
| InChIKey | FBSHPQFDDADKMA-CYBMUJFWSA-N |
| XLogP | 3.16 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |