C30H37N3O4 — CID 68545589
N-[2-amino-6-[2-(3-amino-2,2-dimethylpropoxy)-4-tert-butylbenzoyl]phenyl]-4-methoxybenzamide (PubChem CID 68545589) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-[2-amino-6-[2-(3-amino-2,2-dimethylpropoxy)-4-tert-butylbenzoyl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[2-amino-6-[2-(3-amino-2,2-dimethylpropoxy)-4-tert-butylbenzoyl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 68545589 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | N-[2-amino-6-[2-(3-amino-2,2-dimethylpropoxy)-4-tert-butylbenzoyl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(N)cccc2C(=O)c2ccc(C(C)(C)C)cc2OCC(C)(C)CN)cc1 |
| InChI | InChI=1S/C30H37N3O4/c1-29(2,3)20-12-15-22(25(16-20)37-18-30(4,5)17-31)27(34)23-8-7-9-24(32)26(23)33-28(35)19-10-13-21(36-6)14-11-19/h7-16H,17-18,31-32H2,1-6H3,(H,33,35) |
| InChIKey | OXJRFAUPJSISOL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|