C36H39N3O7 — CID 68549364
tert-butyl N-[3-[2-[3-amino-2-[(4-methoxybenzoyl)amino]benzoyl]-5-phenylmethoxyphenoxy]propyl]carbamate (PubChem CID 68549364) has the molecular formula C36H39N3O7 and a molecular weight of 625.72 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[3-amino-2-[(4-methoxybenzoyl)amino]benzoyl]-5-phenylmethoxyphenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[3-amino-2-[(4-methoxybenzoyl)amino]benzoyl]-5-phenylmethoxyphenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 68549364 |
| Molecular Formula | C36H39N3O7 |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | tert-butyl N-[3-[2-[3-amino-2-[(4-methoxybenzoyl)amino]benzoyl]-5-phenylmethoxyphenoxy]propyl]carbamate |
| SMILES | COc1ccc(C(=O)Nc2c(N)cccc2C(=O)c2ccc(OCc3ccccc3)cc2OCCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C36H39N3O7/c1-36(2,3)46-35(42)38-20-9-21-44-31-22-27(45-23-24-10-6-5-7-11-24)18-19-28(31)33(40)29-12-8-13-30(37)32(29)39-34(41)25-14-16-26(43-4)17-15-25/h5-8,10-19,22H,9,20-21,23,37H2,1-4H3,(H,38,42)(H,39,41) |
| InChIKey | NNZQYONOLXGKEV-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|