C30H35N3O7 — CID 18791195
tert-butyl N-[3-[2-[3-amino-4-[(4-hydroxyphenyl)-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate (PubChem CID 18791195) has the molecular formula C30H35N3O7 and a molecular weight of 549.62 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[3-amino-4-[(4-hydroxyphenyl)-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[3-amino-4-[(4-hydroxyphenyl)-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 18791195 |
| Molecular Formula | C30H35N3O7 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | tert-butyl N-[3-[2-[3-amino-4-[(4-hydroxyphenyl)-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate |
| SMILES | COc1c(C(=O)c2ccccc2OCCCNC(=O)OC(C)(C)C)ccc(C(=O)N(C)c2ccc(O)cc2)c1N |
| InChI | InChI=1S/C30H35N3O7/c1-30(2,3)40-29(37)32-17-8-18-39-24-10-7-6-9-21(24)26(35)23-16-15-22(25(31)27(23)38-5)28(36)33(4)19-11-13-20(34)14-12-19/h6-7,9-16,34H,8,17-18,31H2,1-5H3,(H,32,37) |
| InChIKey | OSECQVBLRRNYEP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|