C35H46N4O7 — CID 70058584
tert-butyl N-[3-[2-[3-amino-4-[[2-(4-aminobutoxy)-4-methylphenyl]-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate (PubChem CID 70058584) has the molecular formula C35H46N4O7 and a molecular weight of 634.77 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[3-amino-4-[[2-(4-aminobutoxy)-4-methylphenyl]-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[3-amino-4-[[2-(4-aminobutoxy)-4-methylphenyl]-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 70058584 |
| Molecular Formula | C35H46N4O7 |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | tert-butyl N-[3-[2-[3-amino-4-[[2-(4-aminobutoxy)-4-methylphenyl]-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate |
| SMILES | COc1c(C(=O)c2ccccc2OCCCNC(=O)OC(C)(C)C)ccc(C(=O)N(C)c2ccc(C)cc2OCCCCN)c1N |
| InChI | InChI=1S/C35H46N4O7/c1-23-14-17-27(29(22-23)45-20-10-9-18-36)39(5)33(41)25-15-16-26(32(43-6)30(25)37)31(40)24-12-7-8-13-28(24)44-21-11-19-38-34(42)46-35(2,3)4/h7-8,12-17,22H,9-11,18-21,36-37H2,1-6H3,(H,38,42) |
| InChIKey | CTBKHBIXRNJIJS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|