C39H53N5O8 — CID 70059175
tert-butyl N-[3-[2-[3-amino-4-[[2-[6-(2,2-dimethylhydrazinyl)-6-oxohexoxy]-4-methylphenyl]-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate (PubChem CID 70059175) has the molecular formula C39H53N5O8 and a molecular weight of 719.88 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[3-amino-4-[[2-[6-(2,2-dimethylhydrazinyl)-6-oxohexoxy]-4-methylphenyl]-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[3-amino-4-[[2-[6-(2,2-dimethylhydrazinyl)-6-oxohexoxy]-4-methylphenyl]-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 70059175 |
| Molecular Formula | C39H53N5O8 |
| Molecular Weight | 719.88 g/mol |
| Exact Mass | 719.39 |
| IUPAC Name | tert-butyl N-[3-[2-[3-amino-4-[[2-[6-(2,2-dimethylhydrazinyl)-6-oxohexoxy]-4-methylphenyl]-methylcarbamoyl]-2-methoxybenzoyl]phenoxy]propyl]carbamate |
| SMILES | COc1c(C(=O)c2ccccc2OCCCNC(=O)OC(C)(C)C)ccc(C(=O)N(C)c2ccc(C)cc2OCCCCCC(=O)NN(C)C)c1N |
| InChI | InChI=1S/C39H53N5O8/c1-26-18-21-30(32(25-26)51-23-13-9-10-17-33(45)42-43(5)6)44(7)37(47)28-19-20-29(36(49-8)34(28)40)35(46)27-15-11-12-16-31(27)50-24-14-22-41-38(48)52-39(2,3)4/h11-12,15-16,18-21,25H,9-10,13-14,17,22-24,40H2,1-8H3,(H,41,48)(H,42,45) |
| InChIKey | MIBSFBBXVLXUEH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 161.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.88 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|