C11H14N2O4 — CID 68546563
tert-butyl N-([1,3]dioxolo[4,5-b]pyridin-7-yl)carbamate (PubChem CID 68546563) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is tert-butyl N-([1,3]dioxolo[4,5-b]pyridin-7-yl)carbamate.
| Compound Name | tert-butyl N-([1,3]dioxolo[4,5-b]pyridin-7-yl)carbamate |
|---|---|
| PubChem CID | 68546563 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | tert-butyl N-([1,3]dioxolo[4,5-b]pyridin-7-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccnc2c1OCO2 |
| InChI | InChI=1S/C11H14N2O4/c1-11(2,3)17-10(14)13-7-4-5-12-9-8(7)15-6-16-9/h4-5H,6H2,1-3H3,(H,12,13,14) |
| InChIKey | SVRGUFUYUICJMV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |