C8H7Cl4FN2 — CID 68551693
2,2,2-trichloro-1-N'-(4-chloro-3-fluorophenyl)ethane-1,1-diamine (PubChem CID 68551693) has the molecular formula C8H7Cl4FN2 and a molecular weight of 291.97 g/mol. Its IUPAC name is 2,2,2-trichloro-1-N'-(4-chloro-3-fluorophenyl)ethane-1,1-diamine.
| Compound Name | 2,2,2-trichloro-1-N'-(4-chloro-3-fluorophenyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 68551693 |
| Molecular Formula | C8H7Cl4FN2 |
| Molecular Weight | 291.97 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 2,2,2-trichloro-1-N'-(4-chloro-3-fluorophenyl)ethane-1,1-diamine |
| SMILES | NC(Nc1ccc(Cl)c(F)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H7Cl4FN2/c9-5-2-1-4(3-6(5)13)15-7(14)8(10,11)12/h1-3,7,15H,14H2 |
| InChIKey | LLOLWMMQVFEGIR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.97 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|