C23H15Cl4NO3 — CID 68552345
2-[[4-chloro-3-(2,3,5-trichlorophenyl)benzoyl]amino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 68552345) has the molecular formula C23H15Cl4NO3 and a molecular weight of 495.19 g/mol. Its IUPAC name is 2-[[4-chloro-3-(2,3,5-trichlorophenyl)benzoyl]amino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[[4-chloro-3-(2,3,5-trichlorophenyl)benzoyl]amino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 68552345 |
| Molecular Formula | C23H15Cl4NO3 |
| Molecular Weight | 495.19 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 2-[[4-chloro-3-(2,3,5-trichlorophenyl)benzoyl]amino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)Cc2ccccc2C1)c1ccc(Cl)c(-c2cc(Cl)cc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C23H15Cl4NO3/c24-15-8-17(20(27)19(26)9-15)16-7-12(5-6-18(16)25)21(29)28-23(22(30)31)10-13-3-1-2-4-14(13)11-23/h1-9H,10-11H2,(H,28,29)(H,30,31) |
| InChIKey | NXPFKHKPICMLKL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.19 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|