C29H23NO3 — CID 68553742
2-[(3,5-diphenylbenzoyl)amino]-1,3-dihydroindene-2-carboxylic acid (PubChem CID 68553742) has the molecular formula C29H23NO3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[(3,5-diphenylbenzoyl)amino]-1,3-dihydroindene-2-carboxylic acid.
| Compound Name | 2-[(3,5-diphenylbenzoyl)amino]-1,3-dihydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 68553742 |
| Molecular Formula | C29H23NO3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[(3,5-diphenylbenzoyl)amino]-1,3-dihydroindene-2-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)Cc2ccccc2C1)c1cc(-c2ccccc2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C29H23NO3/c31-27(30-29(28(32)33)18-22-13-7-8-14-23(22)19-29)26-16-24(20-9-3-1-4-10-20)15-25(17-26)21-11-5-2-6-12-21/h1-17H,18-19H2,(H,30,31)(H,32,33) |
| InChIKey | RNKAJPVVATYNNQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |