C25H27F2N3O4 — CID 68552685
tert-butyl 4-[4-(difluoromethoxy)-3-ethoxy-N-(pyrazin-2-ylmethyl)anilino]benzoate (PubChem CID 68552685) has the molecular formula C25H27F2N3O4 and a molecular weight of 471.50 g/mol. Its IUPAC name is tert-butyl 4-[4-(difluoromethoxy)-3-ethoxy-N-(pyrazin-2-ylmethyl)anilino]benzoate.
| Compound Name | tert-butyl 4-[4-(difluoromethoxy)-3-ethoxy-N-(pyrazin-2-ylmethyl)anilino]benzoate |
|---|---|
| PubChem CID | 68552685 |
| Molecular Formula | C25H27F2N3O4 |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | tert-butyl 4-[4-(difluoromethoxy)-3-ethoxy-N-(pyrazin-2-ylmethyl)anilino]benzoate |
| SMILES | CCOc1cc(N(Cc2cnccn2)c2ccc(C(=O)OC(C)(C)C)cc2)ccc1OC(F)F |
| InChI | InChI=1S/C25H27F2N3O4/c1-5-32-22-14-20(10-11-21(22)33-24(26)27)30(16-18-15-28-12-13-29-18)19-8-6-17(7-9-19)23(31)34-25(2,3)4/h6-15,24H,5,16H2,1-4H3 |
| InChIKey | WLWQQCZIDOFRER-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |