C29H34INO4 — CID 68558007
tert-butyl N-[(2S)-1-(2-iodo-1,1-diphenylethoxy)-3-phenylmethoxypropan-2-yl]carbamate (PubChem CID 68558007) has the molecular formula C29H34INO4 and a molecular weight of 587.50 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-iodo-1,1-diphenylethoxy)-3-phenylmethoxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-iodo-1,1-diphenylethoxy)-3-phenylmethoxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 68558007 |
| Molecular Formula | C29H34INO4 |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 587.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-iodo-1,1-diphenylethoxy)-3-phenylmethoxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COCc1ccccc1)COC(CI)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34INO4/c1-28(2,3)35-27(32)31-26(20-33-19-23-13-7-4-8-14-23)21-34-29(22-30,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,26H,19-22H2,1-3H3,(H,31,32)/t26-/m0/s1 |
| InChIKey | IHUXMSNDWNALFV-SANMLTNESA-N |
| XLogP | 6.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|