C30H46F2N2O7 — CID 68560959
tert-butyl (2R,3S,5R)-2-(cyclohexylmethoxy)-5-[(1S,2S)-3-(3,5-difluorophenyl)-1-hydroxy-2-(3-methoxypropanoylamino)propyl]-3-methylmorpholine-4-carboxylate (PubChem CID 68560959) has the molecular formula C30H46F2N2O7 and a molecular weight of 584.70 g/mol. Its IUPAC name is tert-butyl (2R,3S,5R)-2-(cyclohexylmethoxy)-5-[(1S,2S)-3-(3,5-difluorophenyl)-1-hydroxy-2-(3-methoxypropanoylamino)propyl]-3-methylmorpholine-4-carboxylate.
| Compound Name | tert-butyl (2R,3S,5R)-2-(cyclohexylmethoxy)-5-[(1S,2S)-3-(3,5-difluorophenyl)-1-hydroxy-2-(3-methoxypropanoylamino)propyl]-3-methylmorpholine-4-carboxylate |
|---|---|
| PubChem CID | 68560959 |
| Molecular Formula | C30H46F2N2O7 |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | tert-butyl (2R,3S,5R)-2-(cyclohexylmethoxy)-5-[(1S,2S)-3-(3,5-difluorophenyl)-1-hydroxy-2-(3-methoxypropanoylamino)propyl]-3-methylmorpholine-4-carboxylate |
| SMILES | COCCC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)[C@H]1CO[C@@H](OCC2CCCCC2)[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H46F2N2O7/c1-19-28(39-17-20-9-7-6-8-10-20)40-18-25(34(19)29(37)41-30(2,3)4)27(36)24(33-26(35)11-12-38-5)15-21-13-22(31)16-23(32)14-21/h13-14,16,19-20,24-25,27-28,36H,6-12,15,17-18H2,1-5H3,(H,33,35)/t19-,24-,25+,27-,28+/m0/s1 |
| InChIKey | VUGPWGJXXYOHPQ-LLFHJXMASA-N |
| XLogP | 4.34 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |