C42H52F2N2O2 — CID 68562223
(2S,3R,4S)-2-(4-cyclohexylbutylamino)-4-(dibenzylamino)-5-(3,5-difluorophenyl)-3-phenylmethoxypentan-1-ol (PubChem CID 68562223) has the molecular formula C42H52F2N2O2 and a molecular weight of 654.89 g/mol. Its IUPAC name is (2S,3R,4S)-2-(4-cyclohexylbutylamino)-4-(dibenzylamino)-5-(3,5-difluorophenyl)-3-phenylmethoxypentan-1-ol.
| Compound Name | (2S,3R,4S)-2-(4-cyclohexylbutylamino)-4-(dibenzylamino)-5-(3,5-difluorophenyl)-3-phenylmethoxypentan-1-ol |
|---|---|
| PubChem CID | 68562223 |
| Molecular Formula | C42H52F2N2O2 |
| Molecular Weight | 654.89 g/mol |
| Exact Mass | 654.40 |
| IUPAC Name | (2S,3R,4S)-2-(4-cyclohexylbutylamino)-4-(dibenzylamino)-5-(3,5-difluorophenyl)-3-phenylmethoxypentan-1-ol |
| SMILES | OC[C@H](NCCCCC1CCCCC1)[C@@H](OCc1ccccc1)[C@H](Cc1cc(F)cc(F)c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C42H52F2N2O2/c43-38-25-37(26-39(44)28-38)27-41(46(29-34-18-7-2-8-19-34)30-35-20-9-3-10-21-35)42(48-32-36-22-11-4-12-23-36)40(31-47)45-24-14-13-17-33-15-5-1-6-16-33/h2-4,7-12,18-23,25-26,28,33,40-42,45,47H,1,5-6,13-17,24,27,29-32H2/t40-,41-,42+/m0/s1 |
| InChIKey | LSHMIAMOGPIKPL-WTQYMLSTSA-N |
| XLogP | 8.86 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.89 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|