C22H24ClF3N2O — CID 68562919
2-chloro-N-[[2-[1-(dimethylamino)cyclopentyl]phenyl]methyl]-3-(trifluoromethyl)benzamide (PubChem CID 68562919) has the molecular formula C22H24ClF3N2O and a molecular weight of 424.89 g/mol. Its IUPAC name is 2-chloro-N-[[2-[1-(dimethylamino)cyclopentyl]phenyl]methyl]-3-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[[2-[1-(dimethylamino)cyclopentyl]phenyl]methyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 68562919 |
| Molecular Formula | C22H24ClF3N2O |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-chloro-N-[[2-[1-(dimethylamino)cyclopentyl]phenyl]methyl]-3-(trifluoromethyl)benzamide |
| SMILES | CN(C)C1(c2ccccc2CNC(=O)c2cccc(C(F)(F)F)c2Cl)CCCC1 |
| InChI | InChI=1S/C22H24ClF3N2O/c1-28(2)21(12-5-6-13-21)17-10-4-3-8-15(17)14-27-20(29)16-9-7-11-18(19(16)23)22(24,25)26/h3-4,7-11H,5-6,12-14H2,1-2H3,(H,27,29) |
| InChIKey | YDXUDAKXIIDXAQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |