C17H22N4O — CID 68563753
1-(cyclohexylmethyl)-3-[4-(1H-pyrazol-4-yl)phenyl]urea (PubChem CID 68563753) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-3-[4-(1H-pyrazol-4-yl)phenyl]urea.
| Compound Name | 1-(cyclohexylmethyl)-3-[4-(1H-pyrazol-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 68563753 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 1-(cyclohexylmethyl)-3-[4-(1H-pyrazol-4-yl)phenyl]urea |
| SMILES | O=C(NCC1CCCCC1)Nc1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C17H22N4O/c22-17(18-10-13-4-2-1-3-5-13)21-16-8-6-14(7-9-16)15-11-19-20-12-15/h6-9,11-13H,1-5,10H2,(H,19,20)(H2,18,21,22) |
| InChIKey | FTWZMQWAECOXDD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |