C23H23ClFN3O2 — CID 68563770
5-(3-chloro-4-methoxyphenyl)-5-[3-(3-fluoropropoxy)phenyl]-6,7-dihydropyrrolo[3,4-b]pyridin-7-amine (PubChem CID 68563770) has the molecular formula C23H23ClFN3O2 and a molecular weight of 427.91 g/mol. Its IUPAC name is 5-(3-chloro-4-methoxyphenyl)-5-[3-(3-fluoropropoxy)phenyl]-6,7-dihydropyrrolo[3,4-b]pyridin-7-amine.
| Compound Name | 5-(3-chloro-4-methoxyphenyl)-5-[3-(3-fluoropropoxy)phenyl]-6,7-dihydropyrrolo[3,4-b]pyridin-7-amine |
|---|---|
| PubChem CID | 68563770 |
| Molecular Formula | C23H23ClFN3O2 |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 5-(3-chloro-4-methoxyphenyl)-5-[3-(3-fluoropropoxy)phenyl]-6,7-dihydropyrrolo[3,4-b]pyridin-7-amine |
| SMILES | COc1ccc(C2(c3cccc(OCCCF)c3)NC(N)c3ncccc32)cc1Cl |
| InChI | InChI=1S/C23H23ClFN3O2/c1-29-20-9-8-16(14-19(20)24)23(18-7-3-11-27-21(18)22(26)28-23)15-5-2-6-17(13-15)30-12-4-10-25/h2-3,5-9,11,13-14,22,28H,4,10,12,26H2,1H3 |
| InChIKey | MDVBUMNCTKOHNC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|