C23H21BrClF2NO4S — CID 68563791
N-(2-bromoethyl)-N-[4-chloro-2-[(2,6-difluorophenyl)methyl]phenyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 68563791) has the molecular formula C23H21BrClF2NO4S and a molecular weight of 560.84 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[4-chloro-2-[(2,6-difluorophenyl)methyl]phenyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(2-bromoethyl)-N-[4-chloro-2-[(2,6-difluorophenyl)methyl]phenyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 68563791 |
| Molecular Formula | C23H21BrClF2NO4S |
| Molecular Weight | 560.84 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | N-(2-bromoethyl)-N-[4-chloro-2-[(2,6-difluorophenyl)methyl]phenyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCBr)c2ccc(Cl)cc2Cc2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C23H21BrClF2NO4S/c1-31-22-9-7-17(14-23(22)32-2)33(29,30)28(11-10-24)21-8-6-16(25)12-15(21)13-18-19(26)4-3-5-20(18)27/h3-9,12,14H,10-11,13H2,1-2H3 |
| InChIKey | RHIVQMGFEVKIIU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|