C30H38ClF2NO5SSi — CID 68572431
N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[4-chloro-2-[(2,6-difluorophenyl)methyl]phenyl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 68572431) has the molecular formula C30H38ClF2NO5SSi and a molecular weight of 626.24 g/mol. Its IUPAC name is N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[4-chloro-2-[(2,6-difluorophenyl)methyl]phenyl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[4-chloro-2-[(2,6-difluorophenyl)methyl]phenyl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 68572431 |
| Molecular Formula | C30H38ClF2NO5SSi |
| Molecular Weight | 626.24 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | N-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-N-[4-chloro-2-[(2,6-difluorophenyl)methyl]phenyl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCCO[Si](C)(C)C(C)(C)C)c2ccc(Cl)cc2Cc2c(F)cccc2F)cc1OC |
| InChI | InChI=1S/C30H38ClF2NO5SSi/c1-30(2,3)41(6,7)39-17-9-16-34(40(35,36)23-13-15-28(37-4)29(20-23)38-5)27-14-12-22(31)18-21(27)19-24-25(32)10-8-11-26(24)33/h8,10-15,18,20H,9,16-17,19H2,1-7H3 |
| InChIKey | XEHOHHGDMPLDKR-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.24 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|