C18H22N4O6S — CID 68566420
[8-(4-aminobutylsulfamoyl)-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl] ethyl carbonate (PubChem CID 68566420) has the molecular formula C18H22N4O6S and a molecular weight of 422.46 g/mol. Its IUPAC name is [8-(4-aminobutylsulfamoyl)-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl] ethyl carbonate.
| Compound Name | [8-(4-aminobutylsulfamoyl)-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl] ethyl carbonate |
|---|---|
| PubChem CID | 68566420 |
| Molecular Formula | C18H22N4O6S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [8-(4-aminobutylsulfamoyl)-4-oxo-3,5-dihydropyrrolo[2,3-c]quinolin-1-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1c[nH]c2c(=O)[nH]c3ccc(S(=O)(=O)NCCCCN)cc3c12 |
| InChI | InChI=1S/C18H22N4O6S/c1-2-27-18(24)28-14-10-20-16-15(14)12-9-11(5-6-13(12)22-17(16)23)29(25,26)21-8-4-3-7-19/h5-6,9-10,20-21H,2-4,7-8,19H2,1H3,(H,22,23) |
| InChIKey | NOOXKHJVKSOIES-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 156.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|