C23H31ClN2O2 — CID 68568507
2-(cyclopentylmethoxymethyl)-2-[4-(3-methoxyphenyl)phenyl]imidazolidine;hydrochloride (PubChem CID 68568507) has the molecular formula C23H31ClN2O2 and a molecular weight of 402.97 g/mol. Its IUPAC name is 2-(cyclopentylmethoxymethyl)-2-[4-(3-methoxyphenyl)phenyl]imidazolidine;hydrochloride.
| Compound Name | 2-(cyclopentylmethoxymethyl)-2-[4-(3-methoxyphenyl)phenyl]imidazolidine;hydrochloride |
|---|---|
| PubChem CID | 68568507 |
| Molecular Formula | C23H31ClN2O2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(cyclopentylmethoxymethyl)-2-[4-(3-methoxyphenyl)phenyl]imidazolidine;hydrochloride |
| SMILES | COc1cccc(-c2ccc(C3(COCC4CCCC4)NCCN3)cc2)c1.Cl |
| InChI | InChI=1S/C23H30N2O2.ClH/c1-26-22-8-4-7-20(15-22)19-9-11-21(12-10-19)23(24-13-14-25-23)17-27-16-18-5-2-3-6-18;/h4,7-12,15,18,24-25H,2-3,5-6,13-14,16-17H2,1H3;1H |
| InChIKey | AIFRGNALYXZFSZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |