C18H21IN2S — CID 68569179
4,5-bis(3-methylphenyl)-2-methylsulfanyl-4,5-dihydro-1H-imidazole;hydroiodide (PubChem CID 68569179) has the molecular formula C18H21IN2S and a molecular weight of 424.35 g/mol. Its IUPAC name is 4,5-bis(3-methylphenyl)-2-methylsulfanyl-4,5-dihydro-1H-imidazole;hydroiodide.
| Compound Name | 4,5-bis(3-methylphenyl)-2-methylsulfanyl-4,5-dihydro-1H-imidazole;hydroiodide |
|---|---|
| PubChem CID | 68569179 |
| Molecular Formula | C18H21IN2S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4,5-bis(3-methylphenyl)-2-methylsulfanyl-4,5-dihydro-1H-imidazole;hydroiodide |
| SMILES | CSC1=NC(c2cccc(C)c2)C(c2cccc(C)c2)N1.I |
| InChI | InChI=1S/C18H20N2S.HI/c1-12-6-4-8-14(10-12)16-17(20-18(19-16)21-3)15-9-5-7-13(2)11-15;/h4-11,16-17H,1-3H3,(H,19,20);1H |
| InChIKey | DEEIXIRKGAMDRA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|