C37H38N2O2 — CID 139735098
2-[2-[4,5-bis(3-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-bis(3-methylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 139735098) has the molecular formula C37H38N2O2 and a molecular weight of 542.72 g/mol. Its IUPAC name is 2-[2-[4,5-bis(3-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-bis(3-methylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[2-[4,5-bis(3-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-bis(3-methylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 139735098 |
| Molecular Formula | C37H38N2O2 |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | 2-[2-[4,5-bis(3-methylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]propan-2-yl]-4,5-bis(3-methylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1cccc(C2N=C(C(C)(C)C3=NC(c4cccc(C)c4)C(c4cccc(C)c4)O3)OC2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C37H38N2O2/c1-23-11-7-15-27(19-23)31-33(29-17-9-13-25(3)21-29)40-35(38-31)37(5,6)36-39-32(28-16-8-12-24(2)20-28)34(41-36)30-18-10-14-26(4)22-30/h7-22,31-34H,1-6H3 |
| InChIKey | JKKAIDBYVGLJBC-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |