C39H34N2O2 — CID 155888910
2-[2-(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)-1-phenylpropan-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole (PubChem CID 155888910) has the molecular formula C39H34N2O2 and a molecular weight of 562.71 g/mol. Its IUPAC name is 2-[2-(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)-1-phenylpropan-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[2-(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)-1-phenylpropan-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 155888910 |
| Molecular Formula | C39H34N2O2 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | 2-[2-(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)-1-phenylpropan-2-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(Cc1ccccc1)(C1=NC(c2ccccc2)C(c2ccccc2)O1)C1=NC(c2ccccc2)C(c2ccccc2)O1 |
| InChI | InChI=1S/C39H34N2O2/c1-39(27-28-17-7-2-8-18-28,37-40-33(29-19-9-3-10-20-29)35(42-37)31-23-13-5-14-24-31)38-41-34(30-21-11-4-12-22-30)36(43-38)32-25-15-6-16-26-32/h2-26,33-36H,27H2,1H3 |
| InChIKey | IGVIJCJVSBUFQB-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |