C32H29N3O2 — CID 23380091
1-(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)-N-[(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]methanamine (PubChem CID 23380091) has the molecular formula C32H29N3O2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)-N-[(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]methanamine.
| Compound Name | 1-(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)-N-[(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 23380091 |
| Molecular Formula | C32H29N3O2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)-N-[(4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl)methyl]methanamine |
| SMILES | c1ccc(C2N=C(CNCC3=NC(c4ccccc4)C(c4ccccc4)O3)OC2c2ccccc2)cc1 |
| InChI | InChI=1S/C32H29N3O2/c1-5-13-23(14-6-1)29-31(25-17-9-3-10-18-25)36-27(34-29)21-33-22-28-35-30(24-15-7-2-8-16-24)32(37-28)26-19-11-4-12-20-26/h1-20,29-33H,21-22H2 |
| InChIKey | GWKGVSHKPDPNSQ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |