C41H47ClN6 — CID 68573390
8-chloro-2-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 68573390) has the molecular formula C41H47ClN6 and a molecular weight of 659.32 g/mol. Its IUPAC name is 8-chloro-2-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-chloro-2-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 68573390 |
| Molecular Formula | C41H47ClN6 |
| Molecular Weight | 659.32 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | 8-chloro-2-methyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole;2,8-dimethyl-5-[2-(6-methyl-3-pyridinyl)ethyl]-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc(CCn2c3c(c4cc(Cl)ccc42)CN(C)CC3)cn1.Cc1ccc2c(c1)c1c(n2CCc2ccc(C)nc2)CCN(C)C1 |
| InChI | InChI=1S/C21H25N3.C20H22ClN3/c1-15-4-7-20-18(12-15)19-14-23(3)10-9-21(19)24(20)11-8-17-6-5-16(2)22-13-17;1-14-3-4-15(12-22-14)7-10-24-19-6-5-16(21)11-17(19)18-13-23(2)9-8-20(18)24/h4-7,12-13H,8-11,14H2,1-3H3;3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | NFOPQLQWBQDWCN-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.32 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|