C12H14BrFO2 — CID 68574881
2-[3-(4-bromo-2-fluorophenyl)propyl]-1,3-dioxolane (PubChem CID 68574881) has the molecular formula C12H14BrFO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is 2-[3-(4-bromo-2-fluorophenyl)propyl]-1,3-dioxolane.
| Compound Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 68574881 |
| Molecular Formula | C12H14BrFO2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-[3-(4-bromo-2-fluorophenyl)propyl]-1,3-dioxolane |
| SMILES | Fc1cc(Br)ccc1CCCC1OCCO1 |
| InChI | InChI=1S/C12H14BrFO2/c13-10-5-4-9(11(14)8-10)2-1-3-12-15-6-7-16-12/h4-5,8,12H,1-3,6-7H2 |
| InChIKey | DFUUHIPZTSSPKH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |