C19H24O7 — CID 68575853
3-[4-(2-methylprop-2-enoxy)hexyl]benzene-1,2,4-tricarboxylic acid (PubChem CID 68575853) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is 3-[4-(2-methylprop-2-enoxy)hexyl]benzene-1,2,4-tricarboxylic acid.
| Compound Name | 3-[4-(2-methylprop-2-enoxy)hexyl]benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 68575853 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-[4-(2-methylprop-2-enoxy)hexyl]benzene-1,2,4-tricarboxylic acid |
| SMILES | C=C(C)COC(CC)CCCc1c(C(=O)O)ccc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C19H24O7/c1-4-12(26-10-11(2)3)6-5-7-13-14(17(20)21)8-9-15(18(22)23)16(13)19(24)25/h8-9,12H,2,4-7,10H2,1,3H3,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | BJKHNSGYGRLXQM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|